C20H22N4O4 — CID 167807871
(E)-1-(4-methoxyphenyl)-4-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]but-2-ene-1,4-dione (PubChem CID 167807871) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-4-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]but-2-ene-1,4-dione.
| Compound Name | (E)-1-(4-methoxyphenyl)-4-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 167807871 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-4-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]but-2-ene-1,4-dione |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)N2CCN(c3cc(OC)ncn3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-27-16-5-3-15(4-6-16)17(25)7-8-20(26)24-11-9-23(10-12-24)18-13-19(28-2)22-14-21-18/h3-8,13-14H,9-12H2,1-2H3/b8-7+ |
| InChIKey | IERWHMOHSILATO-BQYQJAHWSA-N |
| XLogP | 1.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|