C15H23N3O4 — CID 167808376
(7S)-7-hydroxy-2-[(2,2,5,5-tetramethyloxolan-3-yl)methyl]-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazine-3,4-dione (PubChem CID 167808376) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (7S)-7-hydroxy-2-[(2,2,5,5-tetramethyloxolan-3-yl)methyl]-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazine-3,4-dione.
| Compound Name | (7S)-7-hydroxy-2-[(2,2,5,5-tetramethyloxolan-3-yl)methyl]-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazine-3,4-dione |
|---|---|
| PubChem CID | 167808376 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (7S)-7-hydroxy-2-[(2,2,5,5-tetramethyloxolan-3-yl)methyl]-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazine-3,4-dione |
| SMILES | CC1(C)CC(Cn2nc3n(c(=O)c2=O)C[C@@H](O)C3)C(C)(C)O1 |
| InChI | InChI=1S/C15H23N3O4/c1-14(2)6-9(15(3,4)22-14)7-18-13(21)12(20)17-8-10(19)5-11(17)16-18/h9-10,19H,5-8H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | IPDIEXXIGUXIQC-AXDSSHIGSA-N |
| XLogP | -0.08 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|