2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid

C12H9NO4 — CID 16780847

IUPAC2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(N2C(=O)C=CC2=O)cc1
InChIInChI=1S/C12H9NO4/c14-10-5-6-11(15)13(10)9-3-1-8(2-4-9)7-12(16)17/h1-6H,7H2,(H,16,17)
InChIKeyKAZUDNXBQPEPGA-UHFFFAOYSA-N
MW231.21 g/mol
LogP0.74
Rot. Bonds3

About 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid

2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid (PubChem CID 16780847) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid
PubChem CID16780847
Molecular FormulaC12H9NO4
Molecular Weight231.21 g/mol
Exact Mass231.05
IUPAC Name2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(N2C(=O)C=CC2=O)cc1
InChIInChI=1S/C12H9NO4/c14-10-5-6-11(15)13(10)9-3-1-8(2-4-9)7-12(16)17/h1-6H,7H2,(H,16,17)
InChIKeyKAZUDNXBQPEPGA-UHFFFAOYSA-N
XLogP0.74
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.21
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid?
The IUPAC name of 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid (CID 16780847) is 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid?
The canonical SMILES for 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid is O=C(O)Cc1ccc(N2C(=O)C=CC2=O)cc1.
What is the InChIKey of 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid?
The InChIKey is KAZUDNXBQPEPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-10-5-6-11(15)13(10)9-3-1-8(2-4-9)7-12(16)17/h1-6H,7H2,(H,16,17).
What are the key properties of 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid?
2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid has a molecular weight of 231.21 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetic acid is sourced from PubChem (CID 16780847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).