About N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline
N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline (PubChem CID 167808569) has the molecular formula C14H17N3O3S2
and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline.
Molecular Properties
| Compound Name | N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline |
| PubChem CID | 167808569 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline |
| SMILES | COc1cc(NCc2nnc(C3CC3)s2)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-20-11-5-10(6-12(7-11)22(2,18)19)15-8-13-16-17-14(21-13)9-3-4-9/h5-7,9,15H,3-4,8H2,1-2H3 |
| InChIKey | LHNJLSFEDRMZNN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline?
The IUPAC name of N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline (CID 167808569) is N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline.
What is the SMILES notation for N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline?
The canonical SMILES for N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline is COc1cc(NCc2nnc(C3CC3)s2)cc(S(C)(=O)=O)c1.
What is the InChIKey of N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline?
The InChIKey is LHNJLSFEDRMZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S2/c1-20-11-5-10(6-12(7-11)22(2,18)19)15-8-13-16-17-14(21-13)9-3-4-9/h5-7,9,15H,3-4,8H2,1-2H3.
What are the key properties of N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline?
N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline has a molecular weight of 339.44 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-methoxy-5-methylsulfonylaniline is sourced from PubChem (CID 167808569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).