About 2-methylbutanehydrazide
2-methylbutanehydrazide (PubChem CID 16780899) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-methylbutanehydrazide.
Molecular Properties
| Compound Name | 2-methylbutanehydrazide |
| PubChem CID | 16780899 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 2-methylbutanehydrazide |
| SMILES | CCC(C)C(=O)NN |
| InChI | InChI=1S/C5H12N2O/c1-3-4(2)5(8)7-6/h4H,3,6H2,1-2H3,(H,7,8) |
| InChIKey | XZHQUWDDJFKLND-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanehydrazide?
The IUPAC name of 2-methylbutanehydrazide (CID 16780899) is 2-methylbutanehydrazide.
What is the SMILES notation for 2-methylbutanehydrazide?
The canonical SMILES for 2-methylbutanehydrazide is CCC(C)C(=O)NN.
What is the InChIKey of 2-methylbutanehydrazide?
The InChIKey is XZHQUWDDJFKLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-4(2)5(8)7-6/h4H,3,6H2,1-2H3,(H,7,8).
What are the key properties of 2-methylbutanehydrazide?
2-methylbutanehydrazide has a molecular weight of 116.16 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanehydrazide is sourced from PubChem (CID 16780899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).