About 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one
1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one (PubChem CID 167811483) has the molecular formula C16H14N4O3S
and a molecular weight of 342.38 g/mol. Its IUPAC name is 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one |
| PubChem CID | 167811483 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one |
| SMILES | Cn1nnc2cc(CN3c4ccccc4C(=O)CS3(=O)=O)ccc21 |
| InChI | InChI=1S/C16H14N4O3S/c1-19-15-7-6-11(8-13(15)17-18-19)9-20-14-5-3-2-4-12(14)16(21)10-24(20,22)23/h2-8H,9-10H2,1H3 |
| InChIKey | LQFLWJIXDCEJIU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The IUPAC name of 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one (CID 167811483) is 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one.
What is the SMILES notation for 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The canonical SMILES for 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one is Cn1nnc2cc(CN3c4ccccc4C(=O)CS3(=O)=O)ccc21.
What is the InChIKey of 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The InChIKey is LQFLWJIXDCEJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S/c1-19-15-7-6-11(8-13(15)17-18-19)9-20-14-5-3-2-4-12(14)16(21)10-24(20,22)23/h2-8H,9-10H2,1H3.
What are the key properties of 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one?
1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one has a molecular weight of 342.38 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-methylbenzotriazol-5-yl)methyl]-2,2-dioxo-2λ6,1-benzothiazin-4-one is sourced from PubChem (CID 167811483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).