C18H15N3O4S — CID 167812058
3-[2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]-4-oxoquinazoline-5-carbonitrile (PubChem CID 167812058) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-[2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]-4-oxoquinazoline-5-carbonitrile.
| Compound Name | 3-[2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]-4-oxoquinazoline-5-carbonitrile |
|---|---|
| PubChem CID | 167812058 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 3-[2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]-4-oxoquinazoline-5-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(C(O)Cn2cnc3cccc(C#N)c3c2=O)cc1 |
| InChI | InChI=1S/C18H15N3O4S/c1-26(24,25)14-7-5-12(6-8-14)16(22)10-21-11-20-15-4-2-3-13(9-19)17(15)18(21)23/h2-8,11,16,22H,10H2,1H3 |
| InChIKey | ARFCWRUTTWPFLB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |