C10H9Cl2N3O — CID 167813068
5-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole (PubChem CID 167813068) has the molecular formula C10H9Cl2N3O and a molecular weight of 258.11 g/mol. Its IUPAC name is 5-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole.
| Compound Name | 5-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 167813068 |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 5-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9Cl2N3O/c1-6(10-13-5-14-15-10)16-7-2-3-8(11)9(12)4-7/h2-6H,1H3,(H,13,14,15) |
| InChIKey | XQIHLRYGIHPAST-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |