C16H20N2O4 — CID 167813098
methyl (E)-4-[(2-methyl-1-oxo-5,6,7,8-tetrahydroisoquinoline-4-carbonyl)amino]but-2-enoate (PubChem CID 167813098) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl (E)-4-[(2-methyl-1-oxo-5,6,7,8-tetrahydroisoquinoline-4-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(2-methyl-1-oxo-5,6,7,8-tetrahydroisoquinoline-4-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 167813098 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl (E)-4-[(2-methyl-1-oxo-5,6,7,8-tetrahydroisoquinoline-4-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)c1cn(C)c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C16H20N2O4/c1-18-10-13(11-6-3-4-7-12(11)16(18)21)15(20)17-9-5-8-14(19)22-2/h5,8,10H,3-4,6-7,9H2,1-2H3,(H,17,20)/b8-5+ |
| InChIKey | NXGMHHMESYFVBQ-VMPITWQZSA-N |
| XLogP | 0.72 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|