C19H18N6O2 — CID 167813113
N-[4-[2-[2-(1-methyltetrazol-5-yl)anilino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 167813113) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[4-[2-[2-(1-methyltetrazol-5-yl)anilino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[2-(1-methyltetrazol-5-yl)anilino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167813113 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[4-[2-[2-(1-methyltetrazol-5-yl)anilino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)Nc2ccccc2-c2nnnn2C)cc1 |
| InChI | InChI=1S/C19H18N6O2/c1-3-17(26)20-14-10-8-13(9-11-14)12-18(27)21-16-7-5-4-6-15(16)19-22-23-24-25(19)2/h3-11H,1,12H2,2H3,(H,20,26)(H,21,27) |
| InChIKey | QIBDSWYKAJKDOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|