About 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole
5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole (PubChem CID 167813902) has the molecular formula C13H8BrN5S
and a molecular weight of 346.21 g/mol. Its IUPAC name is 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole |
| PubChem CID | 167813902 |
| Molecular Formula | C13H8BrN5S |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole |
| SMILES | Brc1ccc2c(cnn2Cc2ccc3nsnc3c2)n1 |
| InChI | InChI=1S/C13H8BrN5S/c14-13-4-3-12-11(16-13)6-15-19(12)7-8-1-2-9-10(5-8)18-20-17-9/h1-6H,7H2 |
| InChIKey | HGCISHIAQZOPJQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole?
The IUPAC name of 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole (CID 167813902) is 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole.
What is the SMILES notation for 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole?
The canonical SMILES for 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole is Brc1ccc2c(cnn2Cc2ccc3nsnc3c2)n1.
What is the InChIKey of 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole?
The InChIKey is HGCISHIAQZOPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN5S/c14-13-4-3-12-11(16-13)6-15-19(12)7-8-1-2-9-10(5-8)18-20-17-9/h1-6H,7H2.
What are the key properties of 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole?
5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole has a molecular weight of 346.21 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-bromopyrazolo[4,5-b]pyridin-1-yl)methyl]-2,1,3-benzothiadiazole is sourced from PubChem (CID 167813902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).