C19H29NO4 — CID 167814221
4-[[2-(5-oxaspiro[3.5]nonan-6-yl)acetyl]amino]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 167814221) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-[[2-(5-oxaspiro[3.5]nonan-6-yl)acetyl]amino]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[[2-(5-oxaspiro[3.5]nonan-6-yl)acetyl]amino]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 167814221 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[[2-(5-oxaspiro[3.5]nonan-6-yl)acetyl]amino]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | O=C(CC1CCCC2(CCC2)O1)NC12CCC(C(=O)O)(CC1)CC2 |
| InChI | InChI=1S/C19H29NO4/c21-15(13-14-3-1-4-19(24-14)5-2-6-19)20-18-10-7-17(8-11-18,9-12-18)16(22)23/h14H,1-13H2,(H,20,21)(H,22,23) |
| InChIKey | SSOKBJPMOGWHAE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |