C16H20N4O2S — CID 167814480
1-(3-methyl-1,2-thiazol-5-yl)-3-[(4-morpholin-4-ylphenyl)methyl]urea (PubChem CID 167814480) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(3-methyl-1,2-thiazol-5-yl)-3-[(4-morpholin-4-ylphenyl)methyl]urea.
| Compound Name | 1-(3-methyl-1,2-thiazol-5-yl)-3-[(4-morpholin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 167814480 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3-methyl-1,2-thiazol-5-yl)-3-[(4-morpholin-4-ylphenyl)methyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2ccc(N3CCOCC3)cc2)sn1 |
| InChI | InChI=1S/C16H20N4O2S/c1-12-10-15(23-19-12)18-16(21)17-11-13-2-4-14(5-3-13)20-6-8-22-9-7-20/h2-5,10H,6-9,11H2,1H3,(H2,17,18,21) |
| InChIKey | BKPMACSHIYNJRN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|