C19H23F3N4O6S3 — CID 167815513
3-[2-[[4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167815513) has the molecular formula C19H23F3N4O6S3 and a molecular weight of 556.61 g/mol. Its IUPAC name is 3-[2-[[4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167815513 |
| Molecular Formula | C19H23F3N4O6S3 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 3-[2-[[4-methyl-2-(2,5,6-trimethyl-3-oxopyridazin-4-yl)-1,3-thiazole-5-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(-c2c(C)c(C)nn(C)c2=O)sc1C(=O)NCCSSCCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4O4S3.C2HF3O2/c1-9-10(2)20-21(4)17(25)13(9)16-19-11(3)14(28-16)15(24)18-6-8-27-26-7-5-12(22)23;3-2(4,5)1(6)7/h5-8H2,1-4H3,(H,18,24)(H,22,23);(H,6,7) |
| InChIKey | BVKRICAQLYJHKX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|