C20H17FN4O2 — CID 167815880
N-[2-(4-fluorophenyl)pyrazol-3-yl]-4-[methyl(prop-2-enoyl)amino]benzamide (PubChem CID 167815880) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)pyrazol-3-yl]-4-[methyl(prop-2-enoyl)amino]benzamide.
| Compound Name | N-[2-(4-fluorophenyl)pyrazol-3-yl]-4-[methyl(prop-2-enoyl)amino]benzamide |
|---|---|
| PubChem CID | 167815880 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-[2-(4-fluorophenyl)pyrazol-3-yl]-4-[methyl(prop-2-enoyl)amino]benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)Nc2ccnn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H17FN4O2/c1-3-19(26)24(2)16-8-4-14(5-9-16)20(27)23-18-12-13-22-25(18)17-10-6-15(21)7-11-17/h3-13H,1H2,2H3,(H,23,27) |
| InChIKey | IKOPOTIKCNJCOM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|