About 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride
3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride (PubChem CID 167815953) has the molecular formula C10H14FN3O4S
and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride |
| PubChem CID | 167815953 |
| Molecular Formula | C10H14FN3O4S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride |
| SMILES | CC1(C)COCCN1C(=O)c1cc(S(=O)(=O)F)[nH]n1 |
| InChI | InChI=1S/C10H14FN3O4S/c1-10(2)6-18-4-3-14(10)9(15)7-5-8(13-12-7)19(11,16)17/h5H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | ZHYVNSOAEYOBQR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride?
The IUPAC name of 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride (CID 167815953) is 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride.
What is the SMILES notation for 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride?
The canonical SMILES for 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride is CC1(C)COCCN1C(=O)c1cc(S(=O)(=O)F)[nH]n1.
What is the InChIKey of 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride?
The InChIKey is ZHYVNSOAEYOBQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3O4S/c1-10(2)6-18-4-3-14(10)9(15)7-5-8(13-12-7)19(11,16)17/h5H,3-4,6H2,1-2H3,(H,12,13).
What are the key properties of 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride?
3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride has a molecular weight of 291.30 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylmorpholine-4-carbonyl)-1H-pyrazole-5-sulfonyl fluoride is sourced from PubChem (CID 167815953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).