About 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide
4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide (PubChem CID 167817061) has the molecular formula C20H27ClN2O
and a molecular weight of 346.90 g/mol. Its IUPAC name is 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide |
| PubChem CID | 167817061 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide |
| SMILES | O=C(NC1[C@H]2CN(CCCC3CCCC3)C[C@@H]12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN2O/c21-16-9-7-15(8-10-16)20(24)22-19-17-12-23(13-18(17)19)11-3-6-14-4-1-2-5-14/h7-10,14,17-19H,1-6,11-13H2,(H,22,24)/t17-,18+,19? |
| InChIKey | QTTRHZHICGPMDK-DFNIBXOVSA-N |
| XLogP | 3.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide?
The IUPAC name of 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide (CID 167817061) is 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide.
What is the SMILES notation for 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide?
The canonical SMILES for 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide is O=C(NC1[C@H]2CN(CCCC3CCCC3)C[C@@H]12)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide?
The InChIKey is QTTRHZHICGPMDK-DFNIBXOVSA-N. The full InChI is InChI=1S/C20H27ClN2O/c21-16-9-7-15(8-10-16)20(24)22-19-17-12-23(13-18(17)19)11-3-6-14-4-1-2-5-14/h7-10,14,17-19H,1-6,11-13H2,(H,22,24)/t17-,18+,19?.
What are the key properties of 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide?
4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide has a molecular weight of 346.90 g/mol, XLogP of 3.97, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(1R,5S)-3-(3-cyclopentylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]benzamide is sourced from PubChem (CID 167817061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).