About 1,3-thiazol-2-ylurea
1,3-thiazol-2-ylurea (PubChem CID 16781708) has the molecular formula C4H5N3OS
and a molecular weight of 143.17 g/mol. Its IUPAC name is 1,3-thiazol-2-ylurea.
Molecular Properties
| Compound Name | 1,3-thiazol-2-ylurea |
| PubChem CID | 16781708 |
| Molecular Formula | C4H5N3OS |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | 1,3-thiazol-2-ylurea |
| SMILES | NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C4H5N3OS/c5-3(8)7-4-6-1-2-9-4/h1-2H,(H3,5,6,7,8) |
| InChIKey | YTQDJZOARIHJGS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-thiazol-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-2-ylurea?
The IUPAC name of 1,3-thiazol-2-ylurea (CID 16781708) is 1,3-thiazol-2-ylurea.
What is the SMILES notation for 1,3-thiazol-2-ylurea?
The canonical SMILES for 1,3-thiazol-2-ylurea is NC(=O)Nc1nccs1.
What is the InChIKey of 1,3-thiazol-2-ylurea?
The InChIKey is YTQDJZOARIHJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3OS/c5-3(8)7-4-6-1-2-9-4/h1-2H,(H3,5,6,7,8).
What are the key properties of 1,3-thiazol-2-ylurea?
1,3-thiazol-2-ylurea has a molecular weight of 143.17 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-2-ylurea is sourced from PubChem (CID 16781708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).