About N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide
N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 167817452) has the molecular formula C14H8ClF3N4O3S
and a molecular weight of 404.76 g/mol. Its IUPAC name is N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| PubChem CID | 167817452 |
| Molecular Formula | C14H8ClF3N4O3S |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1noc(-c2ccccc2Cl)n1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H8ClF3N4O3S/c15-10-4-2-1-3-9(10)12-20-13(21-25-12)22-26(23,24)8-5-6-11(19-7-8)14(16,17)18/h1-7H,(H,21,22) |
| InChIKey | CXSOGENNAZGCQV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The IUPAC name of N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide (CID 167817452) is N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
What is the SMILES notation for N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The canonical SMILES for N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide is O=S(=O)(Nc1noc(-c2ccccc2Cl)n1)c1ccc(C(F)(F)F)nc1.
What is the InChIKey of N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The InChIKey is CXSOGENNAZGCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClF3N4O3S/c15-10-4-2-1-3-9(10)12-20-13(21-25-12)22-26(23,24)8-5-6-11(19-7-8)14(16,17)18/h1-7H,(H,21,22).
What are the key properties of N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide has a molecular weight of 404.76 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-6-(trifluoromethyl)pyridine-3-sulfonamide is sourced from PubChem (CID 167817452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).