C22H19F7N4O3S — CID 167818065
N-[5-(2-fluoro-4-nitrophenyl)-1,3,4-thiadiazol-2-yl]-3-(1,1,2,3,3,3-hexafluoropropyl)adamantane-1-carboxamide (PubChem CID 167818065) has the molecular formula C22H19F7N4O3S and a molecular weight of 552.47 g/mol. Its IUPAC name is N-[5-(2-fluoro-4-nitrophenyl)-1,3,4-thiadiazol-2-yl]-3-(1,1,2,3,3,3-hexafluoropropyl)adamantane-1-carboxamide.
| Compound Name | N-[5-(2-fluoro-4-nitrophenyl)-1,3,4-thiadiazol-2-yl]-3-(1,1,2,3,3,3-hexafluoropropyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 167818065 |
| Molecular Formula | C22H19F7N4O3S |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | N-[5-(2-fluoro-4-nitrophenyl)-1,3,4-thiadiazol-2-yl]-3-(1,1,2,3,3,3-hexafluoropropyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccc([N+](=O)[O-])cc2F)s1)C12CC3CC(C1)CC(C(F)(F)C(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C22H19F7N4O3S/c23-14-4-12(33(35)36)1-2-13(14)15-31-32-18(37-15)30-17(34)19-5-10-3-11(6-19)8-20(7-10,9-19)21(25,26)16(24)22(27,28)29/h1-2,4,10-11,16H,3,5-9H2,(H,30,32,34) |
| InChIKey | NHWMZGWOSCJRJU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|