About 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide
2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 167818787) has the molecular formula C12H16N4O2S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 167818787 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)Nc2ncncc2C(C)C)s1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-7(2)10-5-13-6-14-11(10)16-20(17,18)12-8(3)15-9(4)19-12/h5-7H,1-4H3,(H,13,14,16) |
| InChIKey | XVYUCYLONUVKHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide (CID 167818787) is 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide is Cc1nc(C)c(S(=O)(=O)Nc2ncncc2C(C)C)s1.
What is the InChIKey of 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide?
The InChIKey is XVYUCYLONUVKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S2/c1-7(2)10-5-13-6-14-11(10)16-20(17,18)12-8(3)15-9(4)19-12/h5-7H,1-4H3,(H,13,14,16).
What are the key properties of 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide?
2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide has a molecular weight of 312.42 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N-(5-propan-2-ylpyrimidin-4-yl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 167818787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).