C14H21N5O2S — CID 167819100
2-[2-(diethylamino)ethylsulfanyl]-N-(6-oxo-2,7-dihydropyrazolo[3,4-b]pyridin-3-yl)acetamide (PubChem CID 167819100) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-N-(6-oxo-2,7-dihydropyrazolo[3,4-b]pyridin-3-yl)acetamide.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-N-(6-oxo-2,7-dihydropyrazolo[3,4-b]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 167819100 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-N-(6-oxo-2,7-dihydropyrazolo[3,4-b]pyridin-3-yl)acetamide |
| SMILES | CCN(CC)CCSCC(=O)Nc1[nH]nc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C14H21N5O2S/c1-3-19(4-2)7-8-22-9-12(21)16-14-10-5-6-11(20)15-13(10)17-18-14/h5-6H,3-4,7-9H2,1-2H3,(H3,15,16,17,18,20,21) |
| InChIKey | GNLMUKDUUXGFIV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|