About 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine
6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine (PubChem CID 167819900) has the molecular formula C17H16N6O2
and a molecular weight of 336.36 g/mol. Its IUPAC name is 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 167819900 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine |
| SMILES | COc1ccnc(Cn2cc(-c3cnc4cc[nH]c4c3)nn2)c1OC |
| InChI | InChI=1S/C17H16N6O2/c1-24-16-4-6-19-15(17(16)25-2)10-23-9-14(21-22-23)11-7-13-12(20-8-11)3-5-18-13/h3-9,18H,10H2,1-2H3 |
| InChIKey | INQYCOJNPLPENR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine (CID 167819900) is 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine is COc1ccnc(Cn2cc(-c3cnc4cc[nH]c4c3)nn2)c1OC.
What is the InChIKey of 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is INQYCOJNPLPENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6O2/c1-24-16-4-6-19-15(17(16)25-2)10-23-9-14(21-22-23)11-7-13-12(20-8-11)3-5-18-13/h3-9,18H,10H2,1-2H3.
What are the key properties of 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine?
6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 336.36 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]triazol-4-yl]-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 167819900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).