C20H22N2O2S — CID 167820157
N-(9H-fluoren-2-yl)-7-methyl-1-oxo-1,4-thiazepane-4-carboxamide (PubChem CID 167820157) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-7-methyl-1-oxo-1,4-thiazepane-4-carboxamide.
| Compound Name | N-(9H-fluoren-2-yl)-7-methyl-1-oxo-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 167820157 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(9H-fluoren-2-yl)-7-methyl-1-oxo-1,4-thiazepane-4-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2ccc3c(c2)Cc2ccccc2-3)CCS1=O |
| InChI | InChI=1S/C20H22N2O2S/c1-14-8-9-22(10-11-25(14)24)20(23)21-17-6-7-19-16(13-17)12-15-4-2-3-5-18(15)19/h2-7,13-14H,8-12H2,1H3,(H,21,23) |
| InChIKey | QZGYMUZUDLFEBB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |