C14H18N4O — CID 167821086
N-(2-methylphenyl)-5-(oxan-2-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 167821086) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(2-methylphenyl)-5-(oxan-2-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(2-methylphenyl)-5-(oxan-2-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167821086 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-(2-methylphenyl)-5-(oxan-2-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1ccccc1Nc1n[nH]c(C2CCCCO2)n1 |
| InChI | InChI=1S/C14H18N4O/c1-10-6-2-3-7-11(10)15-14-16-13(17-18-14)12-8-4-5-9-19-12/h2-3,6-7,12H,4-5,8-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | CLQHRSQHZBUENT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |