C19H23N5O2 — CID 167821352
N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide (PubChem CID 167821352) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide.
| Compound Name | N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 167821352 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1nn(CC)nc1C)c1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C19H23N5O2/c1-4-19(26)23(12-17-13(3)21-24(5-2)22-17)15-9-10-16-14(11-15)7-6-8-18(25)20-16/h4,9-11H,1,5-8,12H2,2-3H3,(H,20,25) |
| InChIKey | DIDLHIJDXMXWEL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|