C16H18N4O4S — CID 167821634
2-acetamido-2-methyl-N-[5-methyl-4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 167821634) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-acetamido-2-methyl-N-[5-methyl-4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-acetamido-2-methyl-N-[5-methyl-4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 167821634 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-acetamido-2-methyl-N-[5-methyl-4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(=O)NC(C)(C)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)c(C)s1 |
| InChI | InChI=1S/C16H18N4O4S/c1-9-13(11-6-5-7-12(8-11)20(23)24)17-15(25-9)18-14(22)16(3,4)19-10(2)21/h5-8H,1-4H3,(H,19,21)(H,17,18,22) |
| InChIKey | VZCTXKNSHWZHPD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|