About 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one
3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one (PubChem CID 167821979) has the molecular formula C16H23F3N2O2
and a molecular weight of 332.37 g/mol. Its IUPAC name is 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one |
| PubChem CID | 167821979 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one |
| SMILES | CCCC(O)(Cn1cnc2c(c1=O)CC(C)(C)CC2)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O2/c1-4-6-15(23,16(17,18)19)9-21-10-20-12-5-7-14(2,3)8-11(12)13(21)22/h10,23H,4-9H2,1-3H3 |
| InChIKey | SFVLKYPXNFATQL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one?
The IUPAC name of 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one (CID 167821979) is 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one.
What is the SMILES notation for 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one?
The canonical SMILES for 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one is CCCC(O)(Cn1cnc2c(c1=O)CC(C)(C)CC2)C(F)(F)F.
What is the InChIKey of 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one?
The InChIKey is SFVLKYPXNFATQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F3N2O2/c1-4-6-15(23,16(17,18)19)9-21-10-20-12-5-7-14(2,3)8-11(12)13(21)22/h10,23H,4-9H2,1-3H3.
What are the key properties of 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one?
3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one has a molecular weight of 332.37 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-hydroxy-2-(trifluoromethyl)pentyl]-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-one is sourced from PubChem (CID 167821979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).