C14H22N2O4S2 — CID 167822169
N-(4-sulfamoylbutyl)-1,2,3,4-tetrahydronaphthalene-2-sulfonamide (PubChem CID 167822169) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-(4-sulfamoylbutyl)-1,2,3,4-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(4-sulfamoylbutyl)-1,2,3,4-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 167822169 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(4-sulfamoylbutyl)-1,2,3,4-tetrahydronaphthalene-2-sulfonamide |
| SMILES | NS(=O)(=O)CCCCNS(=O)(=O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H22N2O4S2/c15-21(17,18)10-4-3-9-16-22(19,20)14-8-7-12-5-1-2-6-13(12)11-14/h1-2,5-6,14,16H,3-4,7-11H2,(H2,15,17,18) |
| InChIKey | CGBMBZXAZVMSSE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|