C21H19ClFNO3 — CID 167822777
1-[(1R,5S)-3-(4-chlorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-(4-fluorophenyl)ethane-1,2-dione (PubChem CID 167822777) has the molecular formula C21H19ClFNO3 and a molecular weight of 387.84 g/mol. Its IUPAC name is 1-[(1R,5S)-3-(4-chlorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-(4-fluorophenyl)ethane-1,2-dione.
| Compound Name | 1-[(1R,5S)-3-(4-chlorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-(4-fluorophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 167822777 |
| Molecular Formula | C21H19ClFNO3 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[(1R,5S)-3-(4-chlorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-(4-fluorophenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1[C@@H]2CC[C@H]1CC(O)(c1ccc(Cl)cc1)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19ClFNO3/c22-15-5-3-14(4-6-15)21(27)11-17-9-10-18(12-21)24(17)20(26)19(25)13-1-7-16(23)8-2-13/h1-8,17-18,27H,9-12H2/t17-,18+,21? |
| InChIKey | OZVPZMOEBZNTFF-HTZLVSCSSA-N |
| XLogP | 3.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|