C13H9ClF3N3O3 — CID 167822851
3-chloro-5-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]benzoic acid (PubChem CID 167822851) has the molecular formula C13H9ClF3N3O3 and a molecular weight of 347.68 g/mol. Its IUPAC name is 3-chloro-5-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]benzoic acid.
| Compound Name | 3-chloro-5-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 167822851 |
| Molecular Formula | C13H9ClF3N3O3 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-chloro-5-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)Nc1cc(Cl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H9ClF3N3O3/c14-8-3-7(12(22)23)4-9(5-8)18-11(21)6-20-2-1-10(19-20)13(15,16)17/h1-5H,6H2,(H,18,21)(H,22,23) |
| InChIKey | CFLPJZVURIXRES-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |