About 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine
6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine (PubChem CID 167823968) has the molecular formula C10H14N6O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine.
Molecular Properties
| Compound Name | 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine |
| PubChem CID | 167823968 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine |
| SMILES | CCn1nnc(COc2cc(C)c(C)nn2)n1 |
| InChI | InChI=1S/C10H14N6O/c1-4-16-14-9(12-15-16)6-17-10-5-7(2)8(3)11-13-10/h5H,4,6H2,1-3H3 |
| InChIKey | ZQCJGGXKTZBMMI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine?
The IUPAC name of 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine (CID 167823968) is 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine.
What is the SMILES notation for 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine?
The canonical SMILES for 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine is CCn1nnc(COc2cc(C)c(C)nn2)n1.
What is the InChIKey of 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine?
The InChIKey is ZQCJGGXKTZBMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O/c1-4-16-14-9(12-15-16)6-17-10-5-7(2)8(3)11-13-10/h5H,4,6H2,1-3H3.
What are the key properties of 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine?
6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine has a molecular weight of 234.26 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-ethyltetrazol-5-yl)methoxy]-3,4-dimethylpyridazine is sourced from PubChem (CID 167823968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).