About 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide
2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide (PubChem CID 167824179) has the molecular formula C15H13FN4O
and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide.
Molecular Properties
| Compound Name | 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide |
| PubChem CID | 167824179 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide |
| SMILES | NC(=O)c1ccc(NCc2ccnc3[nH]ccc23)cc1F |
| InChI | InChI=1S/C15H13FN4O/c16-13-7-10(1-2-12(13)14(17)21)20-8-9-3-5-18-15-11(9)4-6-19-15/h1-7,20H,8H2,(H2,17,21)(H,18,19) |
| InChIKey | WCAVFKDQTRTCNW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide?
The IUPAC name of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide (CID 167824179) is 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide.
What is the SMILES notation for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide?
The canonical SMILES for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide is NC(=O)c1ccc(NCc2ccnc3[nH]ccc23)cc1F.
What is the InChIKey of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide?
The InChIKey is WCAVFKDQTRTCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN4O/c16-13-7-10(1-2-12(13)14(17)21)20-8-9-3-5-18-15-11(9)4-6-19-15/h1-7,20H,8H2,(H2,17,21)(H,18,19).
What are the key properties of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide?
2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide has a molecular weight of 284.29 g/mol, XLogP of 2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)benzamide is sourced from PubChem (CID 167824179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).