C17H13F2NO3 — CID 167824242
3-[2-(5,6-difluoro-2,3-dihydroindol-1-yl)-2-oxoethyl]benzoic acid (PubChem CID 167824242) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 3-[2-(5,6-difluoro-2,3-dihydroindol-1-yl)-2-oxoethyl]benzoic acid.
| Compound Name | 3-[2-(5,6-difluoro-2,3-dihydroindol-1-yl)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 167824242 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[2-(5,6-difluoro-2,3-dihydroindol-1-yl)-2-oxoethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CC(=O)N2CCc3cc(F)c(F)cc32)c1 |
| InChI | InChI=1S/C17H13F2NO3/c18-13-8-11-4-5-20(15(11)9-14(13)19)16(21)7-10-2-1-3-12(6-10)17(22)23/h1-3,6,8-9H,4-5,7H2,(H,22,23) |
| InChIKey | CPWXUBQXFLUPRM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |