C19H27N3O — CID 167824474
cyclohex-3-en-1-yl-(2-cyclohexyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone (PubChem CID 167824474) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(2-cyclohexyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | cyclohex-3-en-1-yl-(2-cyclohexyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 167824474 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | cyclohex-3-en-1-yl-(2-cyclohexyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
| SMILES | O=C(C1CC=CCC1)N1CCc2nc(C3CCCCC3)[nH]c2C1 |
| InChI | InChI=1S/C19H27N3O/c23-19(15-9-5-2-6-10-15)22-12-11-16-17(13-22)21-18(20-16)14-7-3-1-4-8-14/h2,5,14-15H,1,3-4,6-13H2,(H,20,21) |
| InChIKey | ZTDMHTOTUQPJQA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|