C21H18F3N3O2S — CID 167825066
[2,2-dimethyl-3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone (PubChem CID 167825066) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is [2,2-dimethyl-3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone.
| Compound Name | [2,2-dimethyl-3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 167825066 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [2,2-dimethyl-3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone |
| SMILES | CC1(C)C(c2cc(F)c(F)c(F)c2)CCN1C(=O)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C21H18F3N3O2S/c1-21(2)14(13-9-15(22)17(24)16(23)10-13)7-8-27(21)19(28)12-5-3-11(4-6-12)18-25-26-20(30)29-18/h3-6,9-10,14H,7-8H2,1-2H3,(H,26,30) |
| InChIKey | YDEUQBUEGTWKCS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|