About 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide
5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide (PubChem CID 167825291) has the molecular formula C17H15N3O2
and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide |
| PubChem CID | 167825291 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]1c1ccccc1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C17H15N3O2/c21-17(15-10-14(19-20-15)16-7-4-8-22-16)18-13-9-12(13)11-5-2-1-3-6-11/h1-8,10,12-13H,9H2,(H,18,21)(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | AVSXXPVDNPVLJI-QWHCGFSZSA-N |
| XLogP | 2.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide (CID 167825291) is 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide is O=C(N[C@@H]1C[C@H]1c1ccccc1)c1cc(-c2ccco2)[nH]n1.
What is the InChIKey of 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide?
The InChIKey is AVSXXPVDNPVLJI-QWHCGFSZSA-N. The full InChI is InChI=1S/C17H15N3O2/c21-17(15-10-14(19-20-15)16-7-4-8-22-16)18-13-9-12(13)11-5-2-1-3-6-11/h1-8,10,12-13H,9H2,(H,18,21)(H,19,20)/t12-,13+/m0/s1.
What are the key properties of 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide?
5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide has a molecular weight of 293.33 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-N-[(1R,2S)-2-phenylcyclopropyl]-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 167825291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).