C14H18ClN3O4S — CID 167825587
2-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N,N-diethylethanesulfonamide (PubChem CID 167825587) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is 2-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N,N-diethylethanesulfonamide.
| Compound Name | 2-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N,N-diethylethanesulfonamide |
|---|---|
| PubChem CID | 167825587 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N,N-diethylethanesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)CCn1c(=O)[nH]c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C14H18ClN3O4S/c1-3-17(4-2)23(21,22)8-7-18-13(19)11-6-5-10(15)9-12(11)16-14(18)20/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,20) |
| InChIKey | KVDVRQNRSCOGLZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |