About 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole
5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole (PubChem CID 167826120) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole.
Molecular Properties
| Compound Name | 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole |
| PubChem CID | 167826120 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole |
| SMILES | Cc1nn(C)cc1-c1cnnn1C |
| InChI | InChI=1S/C8H11N5/c1-6-7(5-12(2)10-6)8-4-9-11-13(8)3/h4-5H,1-3H3 |
| InChIKey | MMWSRABLKQASKN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole?
The IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole (CID 167826120) is 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole.
What is the SMILES notation for 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole?
The canonical SMILES for 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole is Cc1nn(C)cc1-c1cnnn1C.
What is the InChIKey of 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole?
The InChIKey is MMWSRABLKQASKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-6-7(5-12(2)10-6)8-4-9-11-13(8)3/h4-5H,1-3H3.
What are the key properties of 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole?
5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole has a molecular weight of 177.21 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpyrazol-4-yl)-1-methyltriazole is sourced from PubChem (CID 167826120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).