About 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine
6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 167826913) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine |
| PubChem CID | 167826913 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cc(NCc2cnoc2C)ncn1 |
| InChI | InChI=1S/C10H12N4O/c1-7-3-10(13-6-12-7)11-4-9-5-14-15-8(9)2/h3,5-6H,4H2,1-2H3,(H,11,12,13) |
| InChIKey | FVGIAPPYKKGERH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine?
The IUPAC name of 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine (CID 167826913) is 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine is Cc1cc(NCc2cnoc2C)ncn1.
What is the InChIKey of 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine?
The InChIKey is FVGIAPPYKKGERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-7-3-10(13-6-12-7)11-4-9-5-14-15-8(9)2/h3,5-6H,4H2,1-2H3,(H,11,12,13).
What are the key properties of 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine?
6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine has a molecular weight of 204.23 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 167826913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).