About N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide
N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide (PubChem CID 167827786) has the molecular formula C26H23N3O2
and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide.
Molecular Properties
| Compound Name | N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide |
| PubChem CID | 167827786 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide |
| SMILES | O=C(NCc1cc2ccccc2[nH]1)C(=O)NC1CCc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H23N3O2/c30-25(27-16-21-14-20-8-4-5-9-23(20)28-21)26(31)29-24-13-12-18-10-11-19(15-22(18)24)17-6-2-1-3-7-17/h1-11,14-15,24,28H,12-13,16H2,(H,27,30)(H,29,31) |
| InChIKey | LBXDQRLUJBNRJU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide?
The IUPAC name of N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide (CID 167827786) is N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide.
What is the SMILES notation for N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide?
The canonical SMILES for N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide is O=C(NCc1cc2ccccc2[nH]1)C(=O)NC1CCc2ccc(-c3ccccc3)cc21.
What is the InChIKey of N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide?
The InChIKey is LBXDQRLUJBNRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O2/c30-25(27-16-21-14-20-8-4-5-9-23(20)28-21)26(31)29-24-13-12-18-10-11-19(15-22(18)24)17-6-2-1-3-7-17/h1-11,14-15,24,28H,12-13,16H2,(H,27,30)(H,29,31).
What are the key properties of N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide?
N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide has a molecular weight of 409.49 g/mol, XLogP of 4.25, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indol-2-ylmethyl)-N'-(6-phenyl-2,3-dihydro-1H-inden-1-yl)oxamide is sourced from PubChem (CID 167827786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).