C10H15FN2O — CID 167828536
5-[(3-fluoro-3-methylpiperidin-1-yl)methyl]-1,2-oxazole (PubChem CID 167828536) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 5-[(3-fluoro-3-methylpiperidin-1-yl)methyl]-1,2-oxazole.
| Compound Name | 5-[(3-fluoro-3-methylpiperidin-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 167828536 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-[(3-fluoro-3-methylpiperidin-1-yl)methyl]-1,2-oxazole |
| SMILES | CC1(F)CCCN(Cc2ccno2)C1 |
| InChI | InChI=1S/C10H15FN2O/c1-10(11)4-2-6-13(8-10)7-9-3-5-12-14-9/h3,5H,2,4,6-8H2,1H3 |
| InChIKey | CCBJPUTZLZLZHP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |