C21H18N6O2 — CID 167828807
(6-cyclopropyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone (PubChem CID 167828807) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is (6-cyclopropyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone.
| Compound Name | (6-cyclopropyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 167828807 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (6-cyclopropyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
| SMILES | O=C(c1cc(C2CC2)nc2onc(-c3ccccc3)c12)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C21H18N6O2/c28-21(26-8-9-27-12-22-24-17(27)11-26)15-10-16(13-6-7-13)23-20-18(15)19(25-29-20)14-4-2-1-3-5-14/h1-5,10,12-13H,6-9,11H2 |
| InChIKey | YPKLFGPXFQSGHU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |