C18H29F3N2O5 — CID 167829172
2-ethyl-2-(4-pyrrolidin-2-ylpiperidine-1-carbonyl)butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167829172) has the molecular formula C18H29F3N2O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-ethyl-2-(4-pyrrolidin-2-ylpiperidine-1-carbonyl)butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-ethyl-2-(4-pyrrolidin-2-ylpiperidine-1-carbonyl)butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167829172 |
| Molecular Formula | C18H29F3N2O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-ethyl-2-(4-pyrrolidin-2-ylpiperidine-1-carbonyl)butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)N1CCC(C2CCCN2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H28N2O3.C2HF3O2/c1-3-16(4-2,15(20)21)14(19)18-10-7-12(8-11-18)13-6-5-9-17-13;3-2(4,5)1(6)7/h12-13,17H,3-11H2,1-2H3,(H,20,21);(H,6,7) |
| InChIKey | PFNMKEIRJGEAEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|