About N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide
N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide (PubChem CID 167829767) has the molecular formula C15H18N4O2S
and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide.
Molecular Properties
| Compound Name | N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide |
| PubChem CID | 167829767 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide |
| SMILES | O=C(CCc1ncccn1)Nc1ncc(C2CCOCC2)s1 |
| InChI | InChI=1S/C15H18N4O2S/c20-14(3-2-13-16-6-1-7-17-13)19-15-18-10-12(22-15)11-4-8-21-9-5-11/h1,6-7,10-11H,2-5,8-9H2,(H,18,19,20) |
| InChIKey | RSPNAYHGQODOCB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide?
The IUPAC name of N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide (CID 167829767) is N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide.
What is the SMILES notation for N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide?
The canonical SMILES for N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide is O=C(CCc1ncccn1)Nc1ncc(C2CCOCC2)s1.
What is the InChIKey of N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide?
The InChIKey is RSPNAYHGQODOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2S/c20-14(3-2-13-16-6-1-7-17-13)19-15-18-10-12(22-15)11-4-8-21-9-5-11/h1,6-7,10-11H,2-5,8-9H2,(H,18,19,20).
What are the key properties of N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide?
N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide has a molecular weight of 318.40 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]-3-pyrimidin-2-ylpropanamide is sourced from PubChem (CID 167829767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).