C16H28N6 — CID 167830308
4-[(4aS,7aS)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 167830308) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-[(4aS,7aS)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-[(4aS,7aS)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 167830308 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 4-[(4aS,7aS)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCC[C@H]3CN(C)C[C@H]32)n1 |
| InChI | InChI=1S/C16H28N6/c1-11(2)14-17-15(20(3)4)19-16(18-14)22-8-6-7-12-9-21(5)10-13(12)22/h11-13H,6-10H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | SOSUWHSEPUVNAG-QWHCGFSZSA-N |
| XLogP | 1.59 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |