C16H22N6O3 — CID 167830350
4-[(3aR,6aS)-2-(5-methyl-1H-1,2,4-triazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-methylpyrrolidin-2-one (PubChem CID 167830350) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[(3aR,6aS)-2-(5-methyl-1H-1,2,4-triazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-methylpyrrolidin-2-one.
| Compound Name | 4-[(3aR,6aS)-2-(5-methyl-1H-1,2,4-triazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 167830350 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[(3aR,6aS)-2-(5-methyl-1H-1,2,4-triazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-methylpyrrolidin-2-one |
| SMILES | Cc1nc(C(=O)N2C[C@@H]3CN(C(=O)C4(C)CNC(=O)C4)C[C@@H]3C2)n[nH]1 |
| InChI | InChI=1S/C16H22N6O3/c1-9-18-13(20-19-9)14(24)21-4-10-6-22(7-11(10)5-21)15(25)16(2)3-12(23)17-8-16/h10-11H,3-8H2,1-2H3,(H,17,23)(H,18,19,20)/t10-,11+,16? |
| InChIKey | ORLSYNMWGOVPHA-SOSAQKQKSA-N |
| XLogP | -0.83 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |