About N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide
N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide (PubChem CID 167831524) has the molecular formula C9H11N3O4S2
and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide |
| PubChem CID | 167831524 |
| Molecular Formula | C9H11N3O4S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide |
| SMILES | CCc1cnc(NS(=O)(=O)c2cc(OC)ns2)o1 |
| InChI | InChI=1S/C9H11N3O4S2/c1-3-6-5-10-9(16-6)12-18(13,14)8-4-7(15-2)11-17-8/h4-5H,3H2,1-2H3,(H,10,12) |
| InChIKey | YKCMYIFYHAXNBN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide?
The IUPAC name of N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide (CID 167831524) is N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide.
What is the SMILES notation for N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide?
The canonical SMILES for N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide is CCc1cnc(NS(=O)(=O)c2cc(OC)ns2)o1.
What is the InChIKey of N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide?
The InChIKey is YKCMYIFYHAXNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4S2/c1-3-6-5-10-9(16-6)12-18(13,14)8-4-7(15-2)11-17-8/h4-5H,3H2,1-2H3,(H,10,12).
What are the key properties of N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide?
N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide has a molecular weight of 289.34 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-1,3-oxazol-2-yl)-3-methoxy-1,2-thiazole-5-sulfonamide is sourced from PubChem (CID 167831524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).