C25H30N4O3 — CID 167831678
3-benzyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-oxophthalazine-1-carboxamide (PubChem CID 167831678) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-benzyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 167831678 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-benzyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-oxophthalazine-1-carboxamide |
| SMILES | CC(C)CN1CCOC(CNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C25H30N4O3/c1-18(2)15-28-12-13-32-20(17-28)14-26-24(30)23-21-10-6-7-11-22(21)25(31)29(27-23)16-19-8-4-3-5-9-19/h3-11,18,20H,12-17H2,1-2H3,(H,26,30) |
| InChIKey | KRHOQMKCKKSBPT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |