C23H30F3N3O5 — CID 167832421
(4E,10S)-10-(2-methylpropyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-6,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid (PubChem CID 167832421) has the molecular formula C23H30F3N3O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is (4E,10S)-10-(2-methylpropyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-6,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid.
| Compound Name | (4E,10S)-10-(2-methylpropyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-6,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167832421 |
| Molecular Formula | C23H30F3N3O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (4E,10S)-10-(2-methylpropyl)spiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-6,3'-azetidine]-8,13-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C[C@H]1CNC(=O)c2ccccc2OC/C=C/C2(CNC2)CC(=O)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N3O3.C2HF3O2/c1-15(2)10-16-12-23-20(26)17-6-3-4-7-18(17)27-9-5-8-21(13-22-14-21)11-19(25)24-16;3-2(4,5)1(6)7/h3-8,15-16,22H,9-14H2,1-2H3,(H,23,26)(H,24,25);(H,6,7)/b8-5+;/t16-;/m0./s1 |
| InChIKey | SHCQTBLXDFACHQ-MENFPUQBSA-N |
| XLogP | 2.51 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|